CymitQuimica logo

CAS 1103976-91-5

:

α-(Dimethylamino)-4-methoxybenzeneacetic acid

Description:
α-(Dimethylamino)-4-methoxybenzeneacetic acid, identified by its CAS number 1103976-91-5, is an organic compound characterized by its aromatic structure and functional groups. It features a dimethylamino group, which contributes to its basicity and potential for forming salts, and a methoxy group that enhances its lipophilicity and may influence its biological activity. The presence of the acetic acid moiety suggests that it can participate in acid-base reactions, making it relevant in various chemical contexts. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of both hydrophobic (aromatic and methoxy) and hydrophilic (carboxylic acid) components. Its structural characteristics may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's stability, reactivity, and potential applications in synthesis or as a pharmaceutical intermediate would depend on its specific interactions with other chemical entities. Overall, α-(Dimethylamino)-4-methoxybenzeneacetic acid represents a versatile compound with potential utility in various chemical and biological applications.
Formula:C11H15NO3
InChI:InChI=1S/C11H15NO3/c1-12(2)10(11(13)14)8-4-6-9(15-3)7-5-8/h4-7,10H,1-3H3,(H,13,14)
InChI key:InChIKey=MLRPRAUQNABPHF-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N(C)C)C1=CC=C(OC)C=C1
Synonyms:
  • Benzeneacetic acid, α-(dimethylamino)-4-methoxy-
  • α-(Dimethylamino)-4-methoxybenzeneacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.