CAS 1104-21-8
:Tris[4-(dimethylamino)phenyl]phosphine
Description:
Tris[4-(dimethylamino)phenyl]phosphine, with the CAS number 1104-21-8, is an organophosphorus compound characterized by its three-dimensional structure, where a phosphorus atom is bonded to three 4-(dimethylamino)phenyl groups. This compound is typically a solid at room temperature and exhibits a high degree of solubility in organic solvents due to its nonpolar aromatic groups. It is known for its strong electron-donating properties, which can enhance its reactivity in various chemical reactions, particularly in the context of catalysis and as a ligand in coordination chemistry. The presence of dimethylamino groups contributes to its basicity and potential nucleophilicity, making it useful in synthetic organic chemistry. Additionally, Tris[4-(dimethylamino)phenyl]phosphine may exhibit interesting optical properties, which can be exploited in materials science and photonics. However, handling this compound requires caution due to potential toxicity associated with the dimethylamino groups, necessitating appropriate safety measures in laboratory settings.
Formula:C24H30N3P
InChI:InChI=1S/C24H30N3P/c1-25(2)19-7-13-22(14-8-19)28(23-15-9-20(10-16-23)26(3)4)24-17-11-21(12-18-24)27(5)6/h7-18H,1-6H3
InChI key:InChIKey=GNETVOUSGGAEDK-UHFFFAOYSA-N
SMILES:P(C1=CC=C(N(C)C)C=C1)(C2=CC=C(N(C)C)C=C2)C3=CC=C(N(C)C)C=C3
Synonyms:- 4,4',4''-phosphanetriyltris(N,N-dimethylaniline)
- 4,4′,4′′-Phosphinidynetris[N,N-dimethylbenzenamine]
- Aniline, 4,4′,4′′-phosphinidynetris[N,N-dimethyl-
- Benzenamine, 4,4′,4′′-phosphinidynetris[N,N-dimethyl-
- NSC 158459
- Tri(4-dimethylaminophenyl)phosphine
- Tris[4-(dimethylamino)phenyl]phosphine
- Tris[p-(dimethylamino)phenyl]phosphine
- 4,4',4''-Phosphinetriyltris(N,N-dimethylaniline)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.