CymitQuimica logo

CAS 1104027-46-4

:

2-Benzyl-5-chloro-1,2,3,4-tetrahydro-2,6-naphthyridine

Description:
2-Benzyl-5-chloro-1,2,3,4-tetrahydro-2,6-naphthyridine is a heterocyclic organic compound characterized by its naphthyridine core, which features a fused bicyclic structure containing nitrogen atoms. This compound typically exhibits a pale yellow to off-white crystalline appearance. The presence of the benzyl group enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. The chlorine substituent at the 5-position introduces additional reactivity and may affect the compound's pharmacological properties. As a tetrahydro derivative, it possesses a saturated framework that can contribute to its stability and reactivity profile. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for various applications, including as a potential drug candidate or in material science. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.
Formula:C15H15ClN2
InChI:InChI=1S/C15H15ClN2/c16-15-14-7-9-18(11-13(14)6-8-17-15)10-12-4-2-1-3-5-12/h1-6,8H,7,9-11H2
InChI key:IUQVIIUHJIPKQK-UHFFFAOYSA-N
SMILES:C1CN(CC2=C1C(=NC=C2)Cl)CC3=CC=CC=C3
Found 3 products.