CAS 110406-33-2
:4-(4-fluorobenzyl)-2-[1-(2-phenylethyl)azepan-4-yl]phthalazin-1(2H)-one hydrochloride (1:1)
Description:
4-(4-fluorobenzyl)-2-[1-(2-phenylethyl)azepan-4-yl]phthalazin-1(2H)-one hydrochloride is a chemical compound characterized by its complex structure, which includes a phthalazinone core, a fluorobenzyl group, and an azepane moiety. This compound is typically classified as a pharmaceutical intermediate or a potential drug candidate due to its unique molecular architecture, which may exhibit biological activity. The presence of the fluorobenzyl group can enhance lipophilicity and influence the compound's pharmacokinetic properties. The azepane ring contributes to the overall three-dimensional conformation, potentially impacting receptor binding and activity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, facilitating formulation and administration in pharmaceutical applications. The compound's specific interactions, stability, and reactivity would depend on its functional groups and the surrounding environment, making it a subject of interest in medicinal chemistry and drug development.
Formula:C29H31ClFN3O
InChI:InChI=1/C29H30FN3O.ClH/c30-24-14-12-23(13-15-24)21-28-26-10-4-5-11-27(26)29(34)33(31-28)25-9-6-18-32(20-17-25)19-16-22-7-2-1-3-8-22;/h1-5,7-8,10-15,25H,6,9,16-21H2;1H
SMILES:c1ccc(cc1)CCN1CCCC(CC1)n1c(=O)c2ccccc2c(Cc2ccc(cc2)F)n1.Cl
Synonyms:- 1(2H)-Phthalazinone, 4-((4-fluorophenyl)methyl)-2-(hexahydro-1-(2-phenylethyl)-1H-azepin-4-yl)-, monohydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
D18024
CAS:D18024 is a phthalazinonderivat with anti-allergic and anti-histamine effect.Formula:C29H31ClFN3OPurity:99.86%Color and Shape:SolidMolecular weight:492.03Ref: TM-T10945
1mg349.00€5mg697.00€10mg888.00€25mg1,395.00€50mg1,783.00€100mg2,530.00€1mL*10mM (DMSO)880.00€d18024
CAS:D18024 is a peptide that belongs to the class of activator peptides. It activates the G-protein-coupled receptor (GPCR) coupled ion channels and can be used as a research tool for studying protein interactions. D18024 inhibits the activity of some ligands and receptors, such as angiotensin II, which are involved in blood pressure regulation. This peptide has been shown to activate protein kinase C, leading to phosphorylation of intracellular proteins.
D18024 is a ligand or inhibitor that binds to certain cell surface receptors and affects their function. This peptide is characterized by its high purity, with no detectable impurities on the HPLC chromatogram. CAS No: 110406-33-2Formula:C29H31ClFN3OPurity:Min. 95%Molecular weight:492 g/mol


