CAS 110407-54-0
:benzyloxycarbonylalanyl-alanyl-prolyl-valine-trifluoromethyl ketone
Description:
Benzyloxycarbonylalanyl-alanyl-prolyl-valine-trifluoromethyl ketone, commonly referred to by its CAS number 110407-54-0, is a synthetic compound that belongs to the class of peptide inhibitors. This substance features a complex structure that includes a trifluoromethyl ketone moiety, which is known for its ability to enhance the lipophilicity and metabolic stability of the compound. The presence of the benzyloxycarbonyl (Z) group indicates that it is likely used in peptide synthesis as a protecting group, facilitating the selective modification of amino acids. The sequence of amino acids—alanyls, proline, and valine—suggests that this compound may exhibit specific biological activities, potentially acting as an inhibitor of certain proteases or enzymes. Its unique structure may also contribute to its pharmacological properties, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its biological activity, mechanism of action, and potential applications in therapeutic contexts.
Formula:C25H33F3N4O6
InChI:InChI=1/C25H33F3N4O6/c1-14(2)19(20(33)25(26,27)28)32-12-8-11-18(32)23(36)31-22(35)15(3)29-21(34)16(4)30-24(37)38-13-17-9-6-5-7-10-17/h5-7,9-10,14-16,18-19H,8,11-13H2,1-4H3,(H,29,34)(H,30,37)(H,31,35,36)/t15-,16-,18-,19?/m0/s1
SMILES:CC(C)C(C(=O)C(F)(F)F)N1CCC[C@H]1C(=O)N=C([C@H](C)N=C([C@H](C)N=C(O)OCc1ccccc1)O)O
Synonyms:- Caapv
- Cbz-ala-ala-pro-ambo-val-CF3
- L-Prolinamide, N-((phenylmethoxy)carbonyl)-L-alanyl-L-alanyl-N-(2-methyl-1-(trifluoroacetyl)propyl)-
- N-[(benzyloxy)carbonyl]-L-alanyl-N-({(2S)-1-[3,3,3-trifluoro-1-(1-methylethyl)-2-oxopropyl]pyrrolidin-2-yl}carbonyl)-L-alaninamide
- Benzyloxycarbonylalanyl-alanyl-prolyl-valine-trifluoromethyl ketone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.