CAS 1104070-94-1

5-Phthalazinecarboxylic acid

Description:

5-Phthalazinecarboxylic acid is an organic compound characterized by its phthalazine core, which is a bicyclic structure containing two nitrogen atoms in the ring. This compound features a carboxylic acid functional group (-COOH) at the 5-position of the phthalazine ring, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid group. The compound may exhibit various chemical reactivity, including potential for hydrogen bonding and participation in condensation reactions. Its structure allows for potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the presence of nitrogen in the phthalazine ring may impart unique electronic properties, making it of interest in materials science and coordination chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₉H₆N₂O₂

InChI: InChI=1S/C9H6N2O2/c12-9(13)7-3-1-2-6-4-10-11-5-8(6)7/h1-5H,(H,12,13)

InChI key: InChIKey=MRCVKQSGAPVWAB-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(C=CC1)C=NN=C2

Synonyms:

• 5-Phthalazinecarboxylic acid