CAS 110411-53-5
:4-Methyl-3-(trifluoromethyl)-5-isoxazolol
Description:
4-Methyl-3-(trifluoromethyl)-5-isoxazolol is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a methyl group and a trifluoromethyl group, which significantly influence its chemical properties and reactivity. The presence of the trifluoromethyl group often enhances lipophilicity and can affect the compound's biological activity, making it of interest in medicinal chemistry. The isoxazole moiety is known for its role in various pharmacological applications, including anti-inflammatory and antimicrobial activities. Additionally, the compound's unique functional groups contribute to its potential as a building block in organic synthesis and material science. Its CAS number, 110411-53-5, allows for easy identification in chemical databases, facilitating research and development in various fields, including pharmaceuticals and agrochemicals. Overall, 4-Methyl-3-(trifluoromethyl)-5-isoxazolol exemplifies the diverse applications of heterocyclic compounds in modern chemistry.
Formula:C5H4F3NO2
InChI:InChI=1S/C5H4F3NO2/c1-2-3(5(6,7)8)9-11-4(2)10/h10H,1H3
InChI key:InChIKey=FAWWJFATPLBBPY-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C(C)=C(O)ON1
Synonyms:- 5-Isoxazolol, 4-methyl-3-(trifluoromethyl)-
- 4-Methyl-3-(trifluoromethyl)-5-isoxazolol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.