CymitQuimica logo

CAS 110427-00-4

:

ethyl 2-methyl-3-(methylamino)propanoate

Description:
Ethyl 2-methyl-3-(methylamino)propanoate, with the CAS number 110427-00-4, is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol (ethanol) and a carboxylic acid. This compound features a branched alkyl chain, specifically a propanoate structure, with a methylamino group that contributes to its unique properties. It is typically a colorless to pale yellow liquid with a characteristic odor. The presence of the methylamino group suggests potential basicity and reactivity, making it of interest in various chemical syntheses and applications. Ethyl 2-methyl-3-(methylamino)propanoate may exhibit moderate solubility in organic solvents and limited solubility in water, which is common for esters. Its molecular structure allows for potential interactions with biological systems, indicating possible pharmacological relevance. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C7H15NO2
InChI:InChI=1/C7H15NO2/c1-4-10-7(9)6(2)5-8-3/h6,8H,4-5H2,1-3H3
InChI key:InChIKey=OBUSVPFFSXYBDT-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(CNC)C
Synonyms:
  • Propanoic Acid, 2-Methyl-3-(Methylamino)-, Ethyl Ester
  • Ethyl 2-methyl-3-(methylamino)propanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.