CAS 1104279-99-3

1H-Pyrazole-4-carboxylic acid, 3-methyl-1-(4-pyridinyl)-

Description:

1H-Pyrazole-4-carboxylic acid, 3-methyl-1-(4-pyridinyl)- is an organic compound characterized by its pyrazole and pyridine functional groups. This compound features a pyrazole ring, which is a five-membered ring containing two nitrogen atoms, and a carboxylic acid group (-COOH) that contributes to its acidic properties. The presence of a methyl group at the 3-position of the pyrazole ring and a pyridine ring at the 1-position enhances its chemical reactivity and potential biological activity. The compound is likely to exhibit polar characteristics due to the carboxylic acid group, which can participate in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the pyridine moiety may contribute to the compound's ability to interact with biological targets, making it of interest in medicinal chemistry. Overall, this compound's unique structure suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.

Formula: C₁₀H₉N₃O₂

InChI: InChI=1S/C10H9N3O2/c1-7-9(10(14)15)6-13(12-7)8-2-4-11-5-3-8/h2-6H,1H3,(H,14,15)

InChI key: InChIKey=FQKTYARPJRYXKL-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CN(N=C1C)C=2C=CN=CC2

Synonyms:

• 1H-Pyrazole-4-carboxylic acid, 3-methyl-1-(4-pyridinyl)-
• 3-Methyl-1-(pyridin-4-yl)-1H-pyrazole-4-carboxylic acid