CymitQuimica logo

CAS 110443-23-7

:

4-[5-(4-methoxyphenoxy)pentoxy]aniline

Description:
4-[5-(4-Methoxyphenoxy)pentoxy]aniline, identified by its CAS number 110443-23-7, is an organic compound characterized by its complex structure that includes an aniline moiety and a pentoxy chain linked through a phenoxy group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, such as moderate solubility in organic solvents and potential hydrophobic characteristics due to the long alkyl chain. The presence of the methoxy group can influence its electronic properties, potentially enhancing its reactivity and solubility in certain solvents. Additionally, the aniline part of the molecule may impart basicity, allowing it to participate in various chemical reactions, including electrophilic substitutions. The compound's structure suggests potential applications in fields such as pharmaceuticals, agrochemicals, or materials science, where its unique properties could be harnessed for specific functions. However, detailed studies would be necessary to fully understand its behavior, stability, and potential applications in various chemical contexts.
Formula:C18H23NO3
InChI:InChI=1/C18H23NO3/c1-20-16-9-11-18(12-10-16)22-14-4-2-3-13-21-17-7-5-15(19)6-8-17/h5-12H,2-4,13-14,19H2,1H3
Synonyms:
  • Aniline, p-(5-(p-methoxyphenoxy)pentyloxy)-
  • 4-{[5-(4-methoxyphenoxy)pentyl]oxy}aniline
  • BRN 3382035
  • M & B 2660
  • 4-13-00-01024 (Beilstein Handbook Reference)
  • p-(5-(p-Methoxyphenoxy)pentyloxy)aniline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.