CAS 110453-78-6
:Methyloctanol; 98%
Description:
Methyloctanol, with the CAS number 110453-78-6, is an organic compound characterized by its structure as an octanol derivative, featuring a methyl group attached to the octanol chain. This substance typically appears as a colorless to pale yellow liquid with a characteristic odor. It is hydrophobic, meaning it does not mix well with water, but is soluble in organic solvents. Methyloctanol is known for its relatively high boiling point and moderate volatility, which makes it useful in various applications, including as a solvent and in the formulation of fragrances and flavorings. Its chemical stability and low toxicity contribute to its appeal in industrial and consumer products. Additionally, it may exhibit properties such as being a surfactant, which can enhance the wetting and spreading of formulations. As with many organic compounds, proper handling and safety measures should be observed to mitigate any potential risks associated with exposure.
Formula:C9H20O
InChI:InChI=1/C9H20O/c1-3-9(2)7-5-4-6-8-10/h9-10H,3-8H2,1-2H3/t9-/m0/s1
SMILES:CC[C@H](C)CCCCCO
Synonyms:- (S)-(+)-6-Methyl-1-octanol
- (6S)-6-methyloctan-1-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(S)-(+)-6-Methyl-1-octanol
CAS:The (+)-isomer of 6-methyl-1-octanol is a chiral, primary alcohol that has been synthesized and characterized. It is an analytical reagent for the determination of hydroxy groups on a molecule. The (+)-isomer is also used as a synthetic intermediate in the synthesis of other bioactive molecules.Formula:C9H20OPurity:Min. 95%Molecular weight:144.25 g/mol(S)-(+)-6-Methyl-1-octanol
CAS:Formula:C9H20OPurity:95.0%Color and Shape:LiquidMolecular weight:144.258(S)-(+)-6-Methyl-1-octanol
CAS:Formula:C9H20OPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:144.26




