CAS 1104630-93-4
:3-Bromothieno[3,2-b]pyridine-2-carboxylic acid
Description:
3-Bromothieno[3,2-b]pyridine-2-carboxylic acid is a heterocyclic compound characterized by the presence of a bromine atom, a thieno ring, and a pyridine structure, along with a carboxylic acid functional group. This compound features a fused bicyclic system, which contributes to its unique chemical properties and potential reactivity. The bromine substituent can influence the compound's electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The carboxylic acid group enhances its solubility in polar solvents and can participate in acid-base reactions. Additionally, the thieno and pyridine moieties may impart biological activity, making this compound of interest in medicinal chemistry and material science. Its specific applications can vary, but it may be explored for use in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. As with many heterocycles, the compound's stability and reactivity can be influenced by the surrounding functional groups and the overall molecular environment.
Formula:C8H4BrNO2S
InChI:InChI=1S/C8H4BrNO2S/c9-5-6-4(2-1-3-10-6)13-7(5)8(11)12/h1-3H,(H,11,12)
InChI key:InChIKey=AQXGWYFJQUCGCC-UHFFFAOYSA-N
SMILES:BrC=1C=2C(SC1C(O)=O)=CC=CN2
Synonyms:- 3-Bromothieno[3,2-b]pyridine-2-carboxylic acid
- Thieno[3,2-b]pyridine-2-carboxylic acid, 3-bromo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Bromothieno[3,2-B]Pyridine-2-Carboxylic Acid
CAS:Formula:C8H4BrNO2SPurity:97%Color and Shape:SolidMolecular weight:258.09193-Bromothieno[3,2-b]pyridine-2-carboxylic acid
CAS:3-Bromothieno[3,2-b]pyridine-2-carboxylic acid (BTPC) is a synthetic compound that has been found to have cytotoxic activity against cancer cells. It has also been shown to induce apoptosis in tumor cell lines and inhibit the growth of colorectal adenocarcinoma cells. BTPC was found to be more potent than the natural product halolactonization, which is a lactone with antitumor activity. The mechanism for BTPC's cytotoxicity involves its inhibition of the synthesis of RNA and DNA, which leads to cell death. This drug also inhibits angiogenesis and reduces blood supply to tumors.Formula:C8H4BrNO2SPurity:Min. 95%Molecular weight:258.09 g/mol


