CAS 1104630-94-5

1,1-Dimethylethyl N-(3-bromothieno[3,2-b]pyridin-2-yl)carbamate

Description:

1,1-Dimethylethyl N-(3-bromothieno[3,2-b]pyridin-2-yl)carbamate, identified by its CAS number 1104630-94-5, is a chemical compound characterized by its unique structural features. It contains a thieno[3,2-b]pyridine moiety, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the bromine atom enhances its reactivity and may influence its pharmacological properties. The dimethyl group attached to the nitrogen atom of the carbamate functional group provides steric hindrance, which can affect the compound's interaction with biological targets. This compound may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. Its potential applications could span various fields, including pharmaceuticals and agrochemicals, where it may serve as a lead compound for further development. However, specific data regarding its toxicity, environmental impact, and detailed physicochemical properties would require further investigation and characterization through experimental studies.

Formula: C₁₂H₁₃BrN₂O₂S

InChI: InChI=1S/C12H13BrN2O2S/c1-12(2,3)17-11(16)15-10-8(13)9-7(18-10)5-4-6-14-9/h4-6H,1-3H3,(H,15,16)

InChI key: InChIKey=FGCLVSRZLNFAGP-UHFFFAOYSA-N

SMILES: BrC=1C=2C(SC1NC(OC(C)(C)C)=O)=CC=CN2

Synonyms:

• Carbamic acid, N-(3-bromothieno[3,2-b]pyridin-2-yl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-(3-bromothieno[3,2-b]pyridin-2-yl)carbamate