CAS 1104636-73-8
:(T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO]ethenylboron
Description:
The chemical substance known as "(T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO]ethenylboron" with CAS number 1104636-73-8 is a boron-containing compound that features a complex structure involving a boron atom coordinated to an ethenyl group and a glycinato ligand. This compound is characterized by its potential applications in medicinal chemistry, particularly in the context of boron neutron capture therapy (BNCT) for cancer treatment. The presence of carboxymethyl and methyl groups suggests that it may exhibit specific interactions with biological molecules, enhancing its therapeutic efficacy. Additionally, the coordination chemistry of boron in this compound may influence its reactivity and stability, making it a subject of interest in both synthetic and biological chemistry. Its unique structural features may also contribute to its solubility and bioavailability, which are critical factors in drug design and development. Overall, this compound represents a fascinating intersection of organic and inorganic chemistry with potential implications in therapeutic applications.
Formula:C7H9BNO4
InChI:InChI=1S/C7H10BNO4/c1-3-8-9(2,4-6(10)12-8)5-7(11)13-8/h3H,1,4-5H2,2H3
InChI key:InChIKey=BTYVVFBJDAQSIE-UHFFFAOYSA-N
SMILES:[CH-](=C)[B+3]12[N](C)(CC(=O)[O-]1)CC(=O)[O-]2
Synonyms:- Boron, [N-[(carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO]ethenyl-, (T-4)-
- Vinylboronic acid MIDA ester
- Vinylboronic methyliminodiacetate
- (T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO]ethenylboron
- Vinylboronic acid MIDA ester 97%
- 6-Methyl-2-vinyl-1,3,6,2-dioxazaborocane-4,8-dione
- 2-Ethenyl-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione
- 4-Methyl-8-vinyldihydro-4l4,8l4-[1,3,2]oxazaborolo[2,3-b][1,3,2]oxazaborole-2,6(3H,5H)-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Methyl-2-vinyl-1,3,6,2-dioxazaborocane-4,8-dione
CAS:Formula:C7H10BNO4Purity:97%Color and Shape:SolidMolecular weight:182.96966-Methyl-2-vinyl-1,3,6,2-dioxazaborocane-4,8-dione
CAS:6-Methyl-2-vinyl-1,3,6,2-dioxazaborocane-4,8-dionePurity:95%Molecular weight:182.97g/mol6-Methyl-2-vinyl-1,3,6,2-dioxazaborocane-4,8-dione
CAS:Formula:C7H10BNO4Purity:97%Color and Shape:SolidMolecular weight:182.97Vinylboronic acid MIDA ester
CAS:Vinylboronic acid MIDA ester is a boronic ester that can be used as an additive to control weeds. It is a mixture of two diastereomers, with the vinyl group on one end of the molecule and the boron atom on the other. Vinylboronic acid MIDA ester has been shown to be more effective than methoxy for weed control, with yields of up to 100%. The addition of this compound to herbicides increases their activity against weeds, which may be due to its ability to increase the solubility of active ingredients.
Formula:C7H10BNO4Purity:Min. 95%Molecular weight:182.97 g/mol



