CAS 1104637-37-7

(T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO]cyclobutylboron

Description:

The chemical substance known as (T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO]cyclobutylboron, with the CAS number 1104637-37-7, is a boron-containing compound that features a cyclobutyl group and a glycinato ligand. This compound is characterized by its unique coordination chemistry, where the boron atom is typically involved in forming stable complexes with various ligands. The presence of the carboxymethyl and N-methyl groups suggests potential for biological activity, possibly influencing its solubility and reactivity in physiological conditions. The compound may exhibit properties relevant to medicinal chemistry, particularly in the context of boron neutron capture therapy (BNCT) or as a potential agent in drug delivery systems. Its structural features indicate that it could participate in various chemical reactions, including coordination with metal ions or interaction with biomolecules. Overall, this compound represents a fascinating area of study within the field of organoboron chemistry and its applications in biochemistry and pharmacology.

Formula: C₉H₁₄BNO₄

InChI: InChI=1S/C9H14BNO4/c1-11-5-8(12)14-10(11,7-3-2-4-7)15-9(13)6-11/h7H,2-6H2,1H3

InChI key: InChIKey=ULECQIZPIGBABC-UHFFFAOYSA-N

SMILES: C[N]12[B+3]([O-]C(=O)C1)([O-]C(=O)C2)[CH-]3CCC3

Synonyms:

• Boron, [N-[(carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO]cyclobutyl-, (T-4)-
• (T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO]cyclobutylboron

Cyclobutylboronic acid MIDA ester

CAS: 1104637-37-7

Formula: C₉H₁₄BNO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 211.0228

Ref: IN-DA003P3X

8-Cyclobutyl-4-methyl-2,6-dioxohexahydro-[1,3,2]oxazaborolo[2,3-b][1,3,2]oxazaborol-4-ium-8-uide

CAS: 1104637-37-7

8-Cyclobutyl-4-methyl-2,6-dioxohexahydro-[1,3,2]oxazaborolo[2,3-b][1,3,2]oxazaborol-4-ium-8-uide

Purity: 97%

Molecular weight: 211.03g/mol

Ref: 54-OR1068699