CAS 110465-94-6
:1-(4-fluorophenyl)-1-(4-(2-N,N-diethylamino)ethoxy)phenyl-2-phenylethylene
Description:
1-(4-fluorophenyl)-1-(4-(2-N,N-diethylamino)ethoxy)phenyl-2-phenylethylene, with CAS number 110465-94-6, is a synthetic organic compound characterized by its complex structure, which includes multiple aromatic rings and an ether functional group. This compound features a fluorinated phenyl group, which can influence its electronic properties and reactivity. The presence of the diethylamino group suggests potential basicity and solubility in organic solvents, making it suitable for various applications in medicinal chemistry and material science. Its structure indicates potential interactions with biological targets, possibly serving as a pharmacophore in drug design. The compound's unique arrangement of substituents may also impart specific optical properties, making it of interest in photonic applications. Overall, its characteristics, including molecular weight, solubility, and reactivity, would be essential for understanding its behavior in chemical reactions and potential applications in various fields.
Formula:C26H28FNO
InChI:InChI=1/C26H28FNO/c1-3-28(4-2)18-19-29-25-16-12-23(13-17-25)26(20-21-8-6-5-7-9-21)22-10-14-24(27)15-11-22/h5-17,20H,3-4,18-19H2,1-2H3/b26-20+
Synonyms:- Fluoro-clomiphene
- 1-Fdepcp
- N,N-diethyl-2-{4-[(Z)-1-(4-fluorophenyl)-2-phenylethenyl]phenoxy}ethanamine
- 1-(4-Fluorophenyl)-1-(4-(2-N,N-diethylamino)ethoxy)phenyl-2-phenylethylene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N,N-Diethyl-2-[4-[(Z)-1-(4-Fluorophenyl)-2-Phenylethenyl]Phenoxy]Ethanamine
CAS:Controlled ProductDiethylstilbestrol (DES) is a synthetic, nonsteroidal estrogen that is used to treat breast cancer and other estrogen-dependent conditions. DES binds to the estrogen receptor and acts as an agonist. It has minimal liver toxicity and is not metabolized by the body because it is rapidly excreted in urine. DES can be synthesized from benzyl chloride and diethylstolbesterol. This process requires two steps: first, benzyl chloride reacts with diethylstilbesterol to form a triazene intermediate; second, treatment of the triazene intermediate with hydrogen chloride yields DES.Formula:C26H28FNOPurity:Min. 95%Molecular weight:389.51 g/mol
