
CAS 110469-25-5
:3-Butynoic acid, anhydride with 3-butynoic acid
Description:
3-Butynoic acid, anhydride with 3-butynoic acid, identified by CAS number 110469-25-5, is a chemical compound that features a unique structure characterized by the presence of a triple bond between carbon atoms, indicative of its alkyne nature. This compound is an anhydride, suggesting that it is derived from the condensation of 3-butynoic acid, which is a carboxylic acid with a terminal alkyne functional group. The presence of the anhydride functional group typically implies reactivity, particularly in condensation reactions or in the formation of esters. The compound may exhibit properties such as moderate volatility and solubility in organic solvents, while its reactivity can be influenced by the presence of the triple bond, which can participate in various chemical reactions, including nucleophilic additions. Additionally, due to the presence of the carboxylic acid moiety, it may also engage in acid-base reactions. Safety considerations should be taken into account, as compounds with alkyne and anhydride functionalities can be hazardous and require proper handling and storage protocols.
Formula:C8H6O3
InChI:InChI=1S/C8H6O3/c1-3-5-7(9)11-8(10)6-4-2/h1-2H,5-6H2
InChI key:InChIKey=UFZNNEXKSSAZDY-UHFFFAOYSA-N
SMILES:C(OC(CC#C)=O)(CC#C)=O
Synonyms:- 3-Butynoic acid, anhydride with 3-butynoic acid
- 3-Butynoic anhydride
- 3-Butynoic acid, anhydride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.