CAS 110475-21-3

5-Ethyl-1,2-dihydro-3H-pyrazol-3-one

Description:

5-Ethyl-1,2-dihydro-3H-pyrazol-3-one, identified by its CAS number 110475-21-3, is a heterocyclic organic compound characterized by a pyrazolone structure. This compound features a five-membered ring containing two nitrogen atoms and is substituted with an ethyl group at the 5-position. The presence of the carbonyl group contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and cyclization. It is typically a white to off-white solid, and its solubility can vary depending on the solvent used. The compound may exhibit biological activity, which can be explored for potential applications in pharmaceuticals or agrochemicals. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity. Overall, 5-Ethyl-1,2-dihydro-3H-pyrazol-3-one is of interest in both synthetic chemistry and potential medicinal applications.

Formula: C₅H₈N₂O

InChI: InChI=1S/C5H8N2O/c1-2-4-3-5(8)7-6-4/h3H,2H2,1H3,(H2,6,7,8)

InChI key: InChIKey=OBTFNIOWJJRVQV-UHFFFAOYSA-N

SMILES: C(C)C1=CC(=O)NN1

Synonyms:

• Pyrazol-3(or 5)-ol, 5(or 3)-ethyl-
• 3H-Pyrazol-3-one, 5-ethyl-1,2-dihydro-
• 3-Ethyl-1H-pyrazol-5-ol
• 5-Ethyl-1,2-dihydro-3H-pyrazol-3-one