CAS 110475-31-5
:Piperazine, 1-(phenylmethyl)-, hydrochloride (1:1)
Description:
Piperazine, 1-(phenylmethyl)-, hydrochloride (1:1), with the CAS number 110475-31-5, is a chemical compound that belongs to the piperazine class of compounds, which are characterized by a six-membered ring containing two nitrogen atoms. This specific compound features a phenylmethyl group attached to the piperazine ring, enhancing its potential for various biological activities. As a hydrochloride salt, it is typically more soluble in water, which is advantageous for pharmaceutical applications. The compound may exhibit psychoactive properties and has been studied for its potential use in treating various conditions, including anxiety and depression. Its molecular structure allows for interactions with neurotransmitter systems, making it a subject of interest in medicinal chemistry. Additionally, it may possess properties that can be exploited in the development of new therapeutic agents. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or side effects.
Formula:C11H16N2·ClH
InChI:InChI=1S/C11H16N2.ClH/c1-2-4-11(5-3-1)10-13-8-6-12-7-9-13;/h1-5,12H,6-10H2;1H
InChI key:InChIKey=HRSFWIYFGGDGQO-UHFFFAOYSA-N
SMILES:C(C1=CC=CC=C1)N2CCNCC2.Cl
Synonyms:- 1-(Phenylmethyl)-piperazine monohydrochloride
- 1-Benzylpiperazine HCl
- 1-Benzylpiprazine Hcl
- 4-Benzylpiperazine hydrochloride
- N-Benzyl piperazine hydrochloride
- Piperazine, 1-(phenylmethyl)-, hydrochloride (1:1)
- Piperazine, 1-(phenylmethyl)-, monohydrochloride
- Piperazine, 1-benzyl-, hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-Benzylpiperazine hydrochloride
CAS:Controlled Product1-Benzylpiperazine hydrochloride (BPZH) is a metabolite of 1-benzylpiperazine (BZP), which is a neurotransmitter and psychostimulant. BPZH has been used in wastewater treatment as an alternative to chlorine for the removal of organic matter and nitrogen. BPZH is also used as an analytical method to detect cocaine, amphetamines, and other psychoactive drugs in human serum samples. BPZH also induces locomotor activity in mice. The primary mechanism of action appears to be related to its ability to inhibit monoamine reuptake through inhibition of dopamine transport. It has also been shown that BPZH inhibits the synthesis of proteins by inhibiting the enzymatic activity of pyridoxal kinase, causing picolinic acid accumulation.
Formula:C11H16N2·HClPurity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:212.72 g/mol
