CymitQuimica logo

CAS 110479-58-8

:

tin(ii) 2,3-naphthalocyanine

Description:
Tin(II) 2,3-naphthalocyanine is a coordination compound characterized by its unique structure and properties. It features a tin ion in the +2 oxidation state coordinated to a naphthalocyanine ligand, which is a polycyclic aromatic compound known for its stability and ability to form complexes with various metal ions. This compound exhibits strong absorbance in the visible region of the electromagnetic spectrum, making it useful in applications such as photodynamic therapy and as a dye in various materials. Tin(II) 2,3-naphthalocyanine is typically characterized by its deep blue to green color, which is indicative of its electronic transitions. Additionally, it possesses good thermal stability and solubility in organic solvents, which enhances its utility in various chemical and industrial processes. Its unique electronic properties also make it a subject of interest in the field of organic electronics and photovoltaics. Overall, tin(II) 2,3-naphthalocyanine is a versatile compound with significant potential in both research and practical applications.
Formula:C48H24N8Sn
InChI:InChI=1/C48H24N8.Sn.2H/c1-2-10-26-18-34-33(17-25(26)9-1)41-49-42(34)54-44-37-21-29-13-5-6-14-30(29)22-38(37)46(51-44)56-48-40-24-32-16-8-7-15-31(32)23-39(40)47(52-48)55-45-36-20-28-12-4-3-11-27(28)19-35(36)43(50-45)53-41;;;/h1-24H;;;/q-2;+2;;/rC48H24N8.H2Sn/c1-2-10-26-18-34-33(17-25(26)9-1)41-49-42(34)54-44-37-21-29-13-5-6-14-30(29)22-38(37)46(51-44)56-48-40-24-32-16-8-7-15-31(32)23-39(40)47(52-48)55-45-36-20-28-12-4-3-11-27(28)19-35(36)43(50-45)53-41;/h1-24H;1H2/q-2;+2
Synonyms:
  • Tin ii 2,3-naphthalocyanine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.