
CAS 110482-98-9
:2,2-Difluoro-4-penten-1-yl 1,1,1-trifluoromethanesulfonate
Description:
2,2-Difluoro-4-penten-1-yl 1,1,1-trifluoromethanesulfonate, with CAS number 110482-98-9, is a chemical compound characterized by its unique structure that includes a pentene backbone and multiple fluorine substituents. This compound is a sulfonate ester, which typically enhances its reactivity, particularly in nucleophilic substitution reactions. The presence of fluorine atoms contributes to its stability and can influence its physical properties, such as boiling point and solubility. Additionally, the trifluoromethanesulfonate group is known for its ability to act as a leaving group in organic reactions, making this compound potentially useful in synthetic chemistry. Its fluorinated nature may also impart specific characteristics such as increased lipophilicity and altered electronic properties, which can be advantageous in various applications, including pharmaceuticals and agrochemicals. However, due to the presence of fluorinated groups, handling and disposal must be approached with caution, considering environmental and health implications associated with fluorinated compounds.
Formula:C6H7F5O3S
InChI:InChI=1S/C6H7F5O3S/c1-2-3-5(7,8)4-14-15(12,13)6(9,10)11/h2H,1,3-4H2
InChI key:InChIKey=QQDLKYJRCPBOGK-UHFFFAOYSA-N
SMILES:S(OCC(CC=C)(F)F)(C(F)(F)F)(=O)=O
Synonyms:- Methanesulfonic acid, trifluoro-, 2,2-difluoro-4-pentenyl ester
- Methanesulfonic acid, 1,1,1-trifluoro-, 2,2-difluoro-4-penten-1-yl ester
- 2,2-Difluoropent-4-en-1-yl trifluoromethanesulfonate
- 2,2-Difluoro-4-penten-1-yl 1,1,1-trifluoromethanesulfonate
- 2,2-Difluoro-4-pentenyl trifluoromethanesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.