
CAS 1105039-60-8
:1-[1-[(4-Methoxyphenyl)methyl]-1H-pyrazol-4-yl]-1-propanone
Description:
1-[1-[(4-Methoxyphenyl)methyl]-1H-pyrazol-4-yl]-1-propanone, with the CAS number 1105039-60-8, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a propanone functional group, indicating the presence of a ketone, and a methoxyphenyl substituent, which contributes to its aromatic properties. The methoxy group enhances the compound's solubility and reactivity, while the pyrazole moiety is often associated with biological activity, making such compounds of interest in medicinal chemistry. The overall structure suggests potential applications in pharmaceuticals, particularly in the development of anti-inflammatory or analgesic agents. Additionally, the presence of the ketone group may influence its reactivity in various chemical reactions, including nucleophilic additions and condensation reactions. As with many organic compounds, the specific physical properties such as melting point, boiling point, and solubility would depend on the molecular interactions and the environment in which the compound is studied.
Formula:C14H16N2O2
InChI:InChI=1S/C14H16N2O2/c1-3-14(17)12-8-15-16(10-12)9-11-4-6-13(18-2)7-5-11/h4-8,10H,3,9H2,1-2H3
InChI key:InChIKey=SZQSVMYOECVAEX-UHFFFAOYSA-N
SMILES:C(N1C=C(C(CC)=O)C=N1)C2=CC=C(OC)C=C2
Synonyms:- 1-Propanone, 1-[1-[(4-methoxyphenyl)methyl]-1H-pyrazol-4-yl]-
- 1-[1-[(4-Methoxyphenyl)methyl]-1H-pyrazol-4-yl]-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.