CAS 110506-34-8
:N-(4-amino-2-methoxyphenyl)-2-methoxyacetamide
Description:
N-(4-amino-2-methoxyphenyl)-2-methoxyacetamide, with the CAS number 110506-34-8, is an organic compound characterized by its amide functional group and aromatic structure. It features a methoxy group, which enhances its solubility and reactivity, and an amino group that can participate in hydrogen bonding and other interactions. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways due to the presence of the amino and methoxy substituents. The compound's properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Additionally, its reactivity may be influenced by the functional groups present, making it a candidate for further chemical modifications or synthesis of derivatives. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards associated with its use.
Formula:C10H14N2O3
InChI:InChI=1/C10H14N2O3/c1-14-6-10(13)12-8-4-3-7(11)5-9(8)15-2/h3-5H,6,11H2,1-2H3,(H,12,13)
SMILES:COCC(=Nc1ccc(cc1OC)N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.