CAS 110506-36-0: N-(4-Amino-2-methoxyphenyl)-2-thiophenecarboxamide

Description:N-(4-Amino-2-methoxyphenyl)-2-thiophenecarboxamide, with the CAS number 110506-36-0, is a chemical compound characterized by its unique structural features, which include an amino group, a methoxy group, and a thiophene ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the amino group suggests it may engage in hydrogen bonding, enhancing its solubility in polar solvents. The methoxy group can influence the electronic properties of the aromatic system, potentially affecting its reactivity and interaction with biological targets. Additionally, the thiophene moiety may impart specific pharmacological properties, as thiophenes are often found in various bioactive compounds. Overall, this compound's characteristics make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to its structure can lead to enhanced efficacy or reduced toxicity. Further studies would be necessary to fully elucidate its biological activity and potential applications.

Formula:C₁₂H₁₂N₂O₂S

InChI:InChI=1S/C12H12N2O2S/c1-16-10-7-8(13)4-5-9(10)14-12(15)11-3-2-6-17-11/h2-7H,13H2,1H3,(H,14,15)

InChI key:InChIKey=VHUBZFLMNOXBJF-UHFFFAOYSA-N

SMILES:O=C(NC1=CC=C(N)C=C1OC)C=2SC=CC2