CAS 11051-88-0
:Cochliodinol
Description:
Cochliodinol is a chemical compound with the CAS number 11051-88-0, primarily known for its role as a natural product derived from certain fungi, particularly those in the genus Cochliobolus. It is characterized by its unique molecular structure, which includes a bicyclic framework and various functional groups that contribute to its biological activity. Cochliodinol has garnered interest in the field of medicinal chemistry due to its potential antifungal and antibacterial properties. It exhibits a moderate level of toxicity, which necessitates careful handling in laboratory settings. The compound is typically studied for its effects on cellular processes and its potential applications in agriculture and pharmaceuticals. Its solubility and stability can vary depending on the solvent and environmental conditions, making it important to consider these factors during experimentation. Overall, Cochliodinol represents a fascinating subject of study within natural product chemistry, with ongoing research aimed at elucidating its mechanisms of action and potential therapeutic uses.
Formula:C32H30N2O4
InChI:InChI=1/C32H30N2O4/c1-17(2)5-7-19-9-11-25-21(13-19)23(15-33-25)27-29(35)31(37)28(32(38)30(27)36)24-16-34-26-12-10-20(14-22(24)26)8-6-18(3)4/h5-6,9-16,33-35,38H,7-8H2,1-4H3
InChI key:InChIKey=ZXRULNXZJSCTQQ-UHFFFAOYSA-N
SMILES:O=C1C(=C(O)C(=O)C(=C1O)C=2C=3C(NC2)=CC=C(CC=C(C)C)C3)C=4C=5C(NC4)=CC=C(CC=C(C)C)C5
Synonyms:- 2,5-Cyclohexadiene-1,4-dione, 2,5-dihydroxy-3,6-bis[5-(3-methyl-2-buten-1-yl)-1H-indol-3-yl]-
- 2,5-Cyclohexadiene-1,4-dione, 2,5-dihydroxy-3,6-bis[5-(3-methyl-2-butenyl)-1H-indol-3-yl]-
- 2,5-Dihydroxy-3,6-bis[5-(3-methyl-2-buten-1-yl)-1H-indol-3-yl]-2,5-cyclohexadiene-1,4-dione
- 2,5-dihydroxy-3,6-bis[5-(3-methylbut-2-en-1-yl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione
- Cochliodinol
- NSC 695240
- 2,5-Dihydroxy-3,6-bis[5-(3-methyl-2-butenyl)-1H-indol-3-yl]-2,5-cyclohexadiene-1,4-dione
- 2,5-Dihydroxy-3,6-bis[5-(3-methyl-2-butenyl)-1H-indol-3-yl]-1,4-benzoquinone
- Cochliodinol,fromChaetomiumglobosum.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
