CAS 1105187-40-3
:Ethyl 7-chloroimidazo[1,2-c]pyrimidine-2-carboxylate
Description:
Ethyl 7-chloroimidazo[1,2-c]pyrimidine-2-carboxylate is a chemical compound characterized by its unique imidazo-pyrimidine structure, which incorporates both imidazole and pyrimidine rings. This compound features a chloro substituent at the 7-position of the imidazo ring and an ethyl ester functional group at the carboxylate position. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the chloro group can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Ethyl 7-chloroimidazo[1,2-c]pyrimidine-2-carboxylate may also possess biological activity, which could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its molecular structure suggests potential applications in drug design and synthesis, especially in the context of compounds that interact with biological targets. As with any chemical, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C9H8ClN3O2
InChI:InChI=1S/C9H8ClN3O2/c1-2-15-9(14)6-4-13-5-11-7(10)3-8(13)12-6/h3-5H,2H2,1H3
InChI key:InChIKey=WMQUXPLJSXZVPY-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1N=C2N(C1)C=NC(Cl)=C2
Synonyms:- Imidazo[1,2-c]pyrimidine-2-carboxylic acid, 7-chloro-, ethyl ester
- Ethyl 7-chloroimidazo[1,2-c]pyrimidine-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
