CAS 1105187-43-6

7-Bromo-4-chlorofuro[3,2-c]pyridine

Description:

7-Bromo-4-chlorofuro[3,2-c]pyridine is a heterocyclic compound characterized by the presence of both bromine and chlorine substituents on a fused ring system that includes a furan and pyridine moiety. This compound typically exhibits a pale to dark solid appearance and is soluble in organic solvents, reflecting its aromatic nature. The presence of halogen atoms (bromine and chlorine) contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The fused ring structure imparts unique electronic properties, which can influence its behavior in biological systems and its potential applications in medicinal chemistry. Additionally, the compound may exhibit interesting pharmacological activities, although specific biological data would depend on empirical studies. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks. Overall, 7-Bromo-4-chlorofuro[3,2-c]pyridine represents a valuable compound in synthetic organic chemistry and drug development.

Formula: C₇H₃BrClNO

InChI: InChI=1S/C7H3BrClNO/c8-5-3-10-7(9)4-1-2-11-6(4)5/h1-3H

SMILES: c1coc2c1c(Cl)ncc2Br

7-Bromo-4-chlorofuro[3,2-c]pyridine

CAS: 1105187-43-6

Formula: C₇H₃BrClNO

Purity: 97%

Molecular weight: 232.4618

Ref: IN-DA008U0V

7-Bromo-4-chlorofuro[3,2-c]pyridine

CAS: 1105187-43-6

7-Bromo-4-chlorofuro[3,2-c]pyridine

Purity: 95%

Molecular weight: 232.46g/mol

Ref: 54-OR83560

7-Bromo-4-chlorofuro[3,2-c]pyridine

CAS: 1105187-43-6

Formula: C₇H₃BrClNO

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 232.46

Ref: 10-F093140

7-Bromo-4-chlorofuro[3,2-c]pyridine

CAS: 1105187-43-6

Versatile small molecule scaffold

Formula: C₇H₃BrClNO

Purity: Min. 95%

Molecular weight: 232.46 g/mol

Ref: 3D-FUB18743