CymitQuimica logo

CAS 1105187-49-2

:

Ethyl 1-(2,2-diethoxyethyl)-5-nitro-1H-pyrrole-2-carboxylate

Description:
Ethyl 1-(2,2-diethoxyethyl)-5-nitro-1H-pyrrole-2-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrrole ring, a nitro group, and an ethyl ester functional group. This compound features a diethoxyethyl substituent, contributing to its solubility and reactivity. The presence of the nitro group typically indicates potential for electrophilic reactions, while the pyrrole ring suggests aromatic properties that may influence its stability and reactivity. Ethyl esters are generally known for their pleasant odors and are often used in organic synthesis and as intermediates in the production of pharmaceuticals. The compound's specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Additionally, safety data would be essential for handling this compound, as nitro compounds can be sensitive and potentially hazardous. Overall, this substance may have applications in organic synthesis, medicinal chemistry, or as a building block for more complex molecules.
Formula:C13H20N2O6
InChI:InChI=1S/C13H20N2O6/c1-4-19-12(20-5-2)9-14-10(13(16)21-6-3)7-8-11(14)15(17)18/h7-8,12H,4-6,9H2,1-3H3
InChI key:InChIKey=WGXFNSFTGHOHPU-UHFFFAOYSA-N
SMILES:C(C(OCC)OCC)N1C(C(OCC)=O)=CC=C1N(=O)=O
Synonyms:
  • 1H-Pyrrole-2-carboxylic acid, 1-(2,2-diethoxyethyl)-5-nitro-, ethyl ester
  • Ethyl 1-(2,2-diethoxyethyl)-5-nitro-1H-pyrrole-2-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.