CAS 1105188-73-5

1,3-Dihydro-1,5-bis(4-methylphenyl)-2H-imidazole-2-thione

Description:

1,3-Dihydro-1,5-bis(4-methylphenyl)-2H-imidazole-2-thione is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing nitrogen atoms. This substance features two 4-methylphenyl groups, contributing to its hydrophobic characteristics and potential applications in organic synthesis and medicinal chemistry. The presence of a thione functional group (–C=S) indicates that it may exhibit unique reactivity, particularly in nucleophilic addition reactions. The compound's molecular structure suggests it may possess interesting biological activities, potentially acting as a ligand or a precursor in various chemical reactions. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in research and industry. As with many organic compounds, safety data should be reviewed before handling, as it may pose risks such as toxicity or environmental hazards. Overall, this compound represents a class of thione-containing imidazoles that are of interest in both academic and industrial chemistry.

Formula: C₁₇H₁₆N₂S

InChI: InChI=1S/C17H16N2S/c1-12-3-7-14(8-4-12)16-11-18-17(20)19(16)15-9-5-13(2)6-10-15/h3-11H,1-2H3,(H,18,20)

InChI key: InChIKey=VCORWRWJRSGBTH-UHFFFAOYSA-N

SMILES: S=C1N(C(=CN1)C2=CC=C(C)C=C2)C3=CC=C(C)C=C3

Synonyms:

• 1,3-Dihydro-1,5-bis(4-methylphenyl)-2H-imidazole-2-thione
• 1,5-Bis(4-methylphenyl)-1H-imidazole-2-thiol
• 3,4-Bis(4-methylphenyl)-1H-imidazole-2-thione
• 2H-Imidazole-2-thione, 1,3-dihydro-1,5-bis(4-methylphenyl)-