CymitQuimica logo

CAS 1105188-88-2

:

1-(2-Furanylmethyl)-1,3-dihydro-5-(4-methylphenyl)-2H-imidazole-2-thione

Description:
1-(2-Furanylmethyl)-1,3-dihydro-5-(4-methylphenyl)-2H-imidazole-2-thione is a chemical compound characterized by its unique structure, which includes a furan ring and an imidazole moiety. The presence of the furan group contributes to its potential reactivity and biological activity, while the imidazole ring is known for its role in various biochemical processes. This compound features a thione functional group, which can influence its chemical properties, such as its ability to act as a nucleophile or participate in coordination chemistry. The 4-methylphenyl substituent enhances its lipophilicity, potentially affecting its solubility and interaction with biological systems. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific applications and behavior would depend on further studies, including its synthesis, stability, and interactions with other molecules.
Formula:C15H14N2OS
InChI:InChI=1S/C15H14N2OS/c1-11-4-6-12(7-5-11)14-9-16-15(19)17(14)10-13-3-2-8-18-13/h2-9H,10H2,1H3,(H,16,19)
InChI key:InChIKey=DGQJUBRJYRMSGH-UHFFFAOYSA-N
SMILES:C(N1C(=CNC1=S)C2=CC=C(C)C=C2)C3=CC=CO3
Synonyms:
  • 1-(2-Furanylmethyl)-1,3-dihydro-5-(4-methylphenyl)-2H-imidazole-2-thione
  • 2H-Imidazole-2-thione, 1-(2-furanylmethyl)-1,3-dihydro-5-(4-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.