CAS 1105189-03-4: 1,3-Dihydro-5-(4-methylphenyl)-1-(2-propen-1-yl)-2H-imidazole-2-thione

Description: 1,3-Dihydro-5-(4-methylphenyl)-1-(2-propen-1-yl)-2H-imidazole-2-thione is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The compound also contains a propenyl group and a para-methylphenyl substituent, which can influence its physical and chemical properties, such as solubility and stability. Typically, compounds of this nature may exhibit various biological activities, making them of interest in medicinal chemistry and drug development. The presence of multiple functional groups suggests potential for diverse interactions with biological targets. Additionally, the compound's molecular structure may allow for specific stereochemical configurations, which can further affect its reactivity and biological efficacy. Overall, this compound represents a complex structure with potential applications in pharmaceuticals and organic synthesis.

Formula: C₁₃H₁₄N₂S

InChI: InChI=1S/C13H14N2S/c1-3-8-15-12(9-14-13(15)16)11-6-4-10(2)5-7-11/h3-7,9H,1,8H2,2H3,(H,14,16)

InChI key: InChIKey=NJZZOWKNVPTPFP-UHFFFAOYSA-N

SMILES: S=C1NC=C(C=2C=CC(=CC2)C)N1CC=C

5-(4-methylphenyl)-1-(prop-2-en-1-yl)-2,3-dihydro-1H-imidazole-2-thione

CAS: 1105189-03-4

• Purity: 98%
• Molecular weight: 230.3300018310547

1-Allyl-5-(4-methylphenyl)-1H-imidazole-2-thiol

CAS: 1105189-03-4

Please enquire for more information about 1-Allyl-5-(4-methylphenyl)-1H-imidazole-2-thiol including the price, delivery time and more detailed …

• Formula: C₁₃H₁₄N₂S
• Purity: Min. 95%
• Molecular weight: 230.33 g/mol