CAS 1105189-06-7
:1,3-Dihydro-1-(2-methoxyethyl)-5-(4-methylphenyl)-2H-imidazole-2-thione
Description:
1,3-Dihydro-1-(2-methoxyethyl)-5-(4-methylphenyl)-2H-imidazole-2-thione is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom within the imidazole framework. The compound also includes a methoxyethyl substituent, which contributes to its solubility and potential reactivity, as well as a para-methylphenyl group that may influence its electronic properties and steric hindrance. The presence of these functional groups suggests that the compound may exhibit interesting biological activities or serve as a precursor in synthetic chemistry. Its molecular structure allows for various interactions, making it a candidate for research in medicinal chemistry or material science. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific environmental conditions and the presence of other reagents.
Formula:C13H16N2OS
InChI:InChI=1S/C13H16N2OS/c1-10-3-5-11(6-4-10)12-9-14-13(17)15(12)7-8-16-2/h3-6,9H,7-8H2,1-2H3,(H,14,17)
InChI key:InChIKey=UPDJCKRWRZDJNI-UHFFFAOYSA-N
SMILES:C(COC)N1C(=CNC1=S)C2=CC=C(C)C=C2
Synonyms:- 2H-Imidazole-2-thione, 1,3-dihydro-1-(2-methoxyethyl)-5-(4-methylphenyl)-
- 1,3-Dihydro-1-(2-methoxyethyl)-5-(4-methylphenyl)-2H-imidazole-2-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.