CAS 1105189-37-4

1-(4-Fluorophenyl)-1,3-dihydro-5-(3-nitrophenyl)-2H-imidazole-2-thione

Description:

1-(4-Fluorophenyl)-1,3-dihydro-5-(3-nitrophenyl)-2H-imidazole-2-thione is a chemical compound characterized by its imidazole core, which is a five-membered heterocyclic ring containing nitrogen atoms. The presence of a fluorophenyl group and a nitrophenyl group contributes to its unique chemical properties, including potential reactivity and biological activity. The thione functional group indicates that the compound contains a sulfur atom double-bonded to a carbon atom, which can influence its stability and reactivity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of electron-withdrawing groups like the nitro group can enhance the compound's reactivity, making it a candidate for further chemical modifications. Overall, this compound's unique structural features and functional groups contribute to its potential utility in various chemical and pharmaceutical applications.

Formula: C₁₅H₁₀FN₃O₂S

InChI: InChI=1S/C15H10FN3O2S/c16-11-4-6-12(7-5-11)18-14(9-17-15(18)22)10-2-1-3-13(8-10)19(20)21/h1-9H,(H,17,22)

InChI key: InChIKey=QRWDPGLAVJVIAX-UHFFFAOYSA-N

SMILES: S=C1N(C(=CN1)C2=CC(N(=O)=O)=CC=C2)C3=CC=C(F)C=C3

Synonyms:

• 1-(4-Fluorophenyl)-1,3-dihydro-5-(3-nitrophenyl)-2H-imidazole-2-thione
• 2H-Imidazole-2-thione, 1-(4-fluorophenyl)-1,3-dihydro-5-(3-nitrophenyl)-