CAS 1105189-41-0

1,3-Dihydro-1-(4-methylphenyl)-5-(3-nitrophenyl)-2H-imidazole-2-thione

Description:

1,3-Dihydro-1-(4-methylphenyl)-5-(3-nitrophenyl)-2H-imidazole-2-thione is a heterocyclic compound characterized by its imidazole ring structure, which contains both sulfur and nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The presence of the 4-methylphenyl and 3-nitrophenyl substituents suggests that it may exhibit interesting electronic properties and could be involved in various chemical interactions. The nitro group is known for its electron-withdrawing effects, which can influence the compound's reactivity and stability. Additionally, the imidazole ring is often associated with biological significance, making this compound a candidate for pharmaceutical research. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvent used. Overall, this compound's unique structure may offer potential applications in medicinal chemistry and materials science.

Formula: C₁₆H₁₃N₃O₂S

InChI: InChI=1S/C16H13N3O2S/c1-11-5-7-13(8-6-11)18-15(10-17-16(18)22)12-3-2-4-14(9-12)19(20)21/h2-10H,1H3,(H,17,22)

InChI key: InChIKey=TZQJHHAERQJUDV-UHFFFAOYSA-N

SMILES: S=C1N(C(=CN1)C2=CC(N(=O)=O)=CC=C2)C3=CC=C(C)C=C3

Synonyms:

• 1,3-Dihydro-1-(4-methylphenyl)-5-(3-nitrophenyl)-2H-imidazole-2-thione
• 2H-Imidazole-2-thione, 1,3-dihydro-1-(4-methylphenyl)-5-(3-nitrophenyl)-