CAS 1105189-48-7

5-Amino-1-(1,1-dimethylethyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one

Description:

5-Amino-1-(1,1-dimethylethyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one is a heterocyclic organic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features an amino group and a tert-butyl substituent, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The compound's structure suggests potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its CAS number, 1105189-48-7, allows for precise identification in chemical databases. The presence of the dihydro group indicates that it may undergo various chemical reactions, including oxidation or substitution, which can be explored for synthetic applications. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development.

Formula: C₉H₁₃N₅O

InChI: InChI=1S/C9H13N5O/c1-9(2,3)14-7-6(4-12-14)8(15)13(10)5-11-7/h4-5H,10H2,1-3H3

InChI key: InChIKey=PZAJUOTWFKOSCD-UHFFFAOYSA-N

SMILES: C(C)(C)(C)N1C2=C(C(=O)N(N)C=N2)C=N1

Synonyms:

• 5-Amino-1-(1,1-dimethylethyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one
• 4H-Pyrazolo[3,4-d]pyrimidin-4-one, 5-amino-1-(1,1-dimethylethyl)-1,5-dihydro-

5-amino-1-tert-butyl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one

CAS: 1105189-48-7

Formula: C₉H₁₃N₅O

Purity: 95.0%

Molecular weight: 207.237

Ref: 10-F520758