CAS 1105189-68-1
:2-Methyl-7-(4-methylphenyl)thiazolo[4,5-d]pyridazin-4(5H)-one
Description:
2-Methyl-7-(4-methylphenyl)thiazolo[4,5-d]pyridazin-4(5H)-one is a heterocyclic compound characterized by its complex structure, which includes a thiazole ring fused to a pyridazine moiety. This compound features a methyl group at the second position and a para-methylphenyl substituent at the seventh position of the thiazole ring. The presence of these functional groups contributes to its unique chemical properties, including potential biological activity. The thiazole and pyridazine rings are known for their roles in various pharmacological applications, making this compound of interest in medicinal chemistry. Its molecular structure suggests it may exhibit specific interactions with biological targets, potentially leading to therapeutic effects. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the rings, which may affect its application in drug development or other chemical processes. Overall, 2-Methyl-7-(4-methylphenyl)thiazolo[4,5-d]pyridazin-4(5H)-one represents a class of compounds that could be explored for various chemical and biological applications.
Formula:C13H11N3OS
InChI:InChI=1S/C13H11N3OS/c1-7-3-5-9(6-4-7)10-12-11(13(17)16-15-10)14-8(2)18-12/h3-6H,1-2H3,(H,16,17)
InChI key:InChIKey=BCLCNEKEUITZTL-UHFFFAOYSA-N
SMILES:O=C1C2=C(C(=NN1)C3=CC=C(C)C=C3)SC(C)=N2
Synonyms:- Thiazolo[4,5-d]pyridazin-4(5H)-one, 2-methyl-7-(4-methylphenyl)-
- 2-Methyl-7-(4-methylphenyl)thiazolo[4,5-d]pyridazin-4(5H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.