CAS 1105189-73-8

Methyl 5-(4-bromophenyl)-2,3-dihydro-2-thioxo-1H-imidazole-1-acetate

Description:

Methyl 5-(4-bromophenyl)-2,3-dihydro-2-thioxo-1H-imidazole-1-acetate is a chemical compound characterized by its imidazole core, which features a thioxo group and an acetate moiety. The presence of a bromophenyl substituent enhances its potential for biological activity, possibly influencing its interaction with various biological targets. This compound is likely to exhibit moderate solubility in organic solvents due to its structural components, while its polar functional groups may impart some degree of hydrophilicity. The thioxo group can contribute to its reactivity, potentially allowing for nucleophilic attack or participation in various chemical reactions. Additionally, the compound may possess interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. As with many synthetic compounds, safety and handling precautions should be observed, given the presence of bromine, which can be hazardous.

Formula: C₁₂H₁₁BrN₂O₂S

InChI: InChI=1S/C12H11BrN2O2S/c1-17-11(16)7-15-10(6-14-12(15)18)8-2-4-9(13)5-3-8/h2-6H,7H2,1H3,(H,14,18)

InChI key: InChIKey=PLNIYAFTORPKKO-UHFFFAOYSA-N

SMILES: C(C(OC)=O)N1C(=CNC1=S)C2=CC=C(Br)C=C2

Synonyms:

• Methyl 5-(4-bromophenyl)-2,3-dihydro-2-thioxo-1H-imidazole-1-acetate
• 1H-Imidazole-1-acetic acid, 5-(4-bromophenyl)-2,3-dihydro-2-thioxo-, methyl ester