CAS 1105189-76-1

Methyl 2-hydroxy-8-methyl-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxylate

Description:

Methyl 2-hydroxy-8-methyl-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxylate, identified by its CAS number 1105189-76-1, is a chemical compound that belongs to the class of pyridopyrimidines. This substance features a pyridine ring fused to a pyrimidine structure, which contributes to its unique chemical properties. It contains a carboxylate group, a hydroxyl group, and a methyl group, which influence its reactivity and solubility. The presence of the keto group (4-oxo) suggests potential for tautomerization and reactivity in various chemical reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require further investigation or experimental determination.

Formula: C₁₁H₁₀N₂O₄

InChI: InChI=1S/C11H10N2O4/c1-6-3-4-13-7(5-6)12-9(14)8(10(13)15)11(16)17-2/h3-5,14H,1-2H3

InChI key: InChIKey=DDEWYAMSCNPNRR-UHFFFAOYSA-N

SMILES: O=C1N2C(=NC(O)=C1C(OC)=O)C=C(C)C=C2

Synonyms:

• Methyl 2-hydroxy-8-methyl-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxylate
• 4H-Pyrido[1,2-a]pyrimidine-3-carboxylic acid, 2-hydroxy-8-methyl-4-oxo-, methyl ester