CymitQuimica logo

CAS 1105189-77-2

:

5-(4-Bromophenyl)-1,3-dihydro-1-(2-propen-1-yl)-2H-imidazole-2-thione

Description:
5-(4-Bromophenyl)-1,3-dihydro-1-(2-propen-1-yl)-2H-imidazole-2-thione is a chemical compound characterized by its imidazole core, which is a five-membered heterocyclic ring containing nitrogen atoms. The presence of a bromophenyl group indicates that there is a bromine atom attached to a phenyl ring, contributing to the compound's potential reactivity and biological activity. The compound also features a propenyl substituent, which can enhance its lipophilicity and influence its interactions with biological targets. As a thione, it contains a sulfur atom double-bonded to a carbon atom, which can impart unique chemical properties, such as the ability to participate in various chemical reactions, including nucleophilic attacks. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific applications and behavior would depend on further studies, including its solubility, stability, and reactivity under different conditions. Overall, this compound represents a complex structure with potential implications in various fields, including pharmaceuticals and materials science.
Formula:C12H11BrN2S
InChI:InChI=1S/C12H11BrN2S/c1-2-7-15-11(8-14-12(15)16)9-3-5-10(13)6-4-9/h2-6,8H,1,7H2,(H,14,16)
InChI key:InChIKey=QBTQKJANMPUOCT-UHFFFAOYSA-N
SMILES:C(C=C)N1C(=CNC1=S)C2=CC=C(Br)C=C2
Synonyms:
  • 5-(4-Bromophenyl)-1,3-dihydro-1-(2-propen-1-yl)-2H-imidazole-2-thione
  • 2H-Imidazole-2-thione, 5-(4-bromophenyl)-1,3-dihydro-1-(2-propen-1-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.