CAS 1105189-99-8

3-[5-(2-Furanyl)-1,3,4-thiadiazol-2-yl]piperidine

Description:

3-[5-(2-Furanyl)-1,3,4-thiadiazol-2-yl]piperidine is a chemical compound characterized by its unique structural features, which include a piperidine ring and a thiadiazole moiety substituted with a furanyl group. The presence of the thiadiazole ring contributes to its potential biological activity, as thiadiazoles are often associated with various pharmacological properties. The furanyl group, derived from furan, adds to the compound's aromatic character and may influence its solubility and reactivity. This compound is likely to exhibit interesting interactions due to the presence of both nitrogen and sulfur atoms in its structure, which can participate in hydrogen bonding and coordination with metal ions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activities, toxicity, and stability would require further investigation through experimental studies. Overall, 3-[5-(2-Furanyl)-1,3,4-thiadiazol-2-yl]piperidine represents a class of compounds that may hold promise for various applications in drug discovery and development.

Formula: C₁₁H₁₃N₃OS

InChI: InChI=1S/C11H13N3OS/c1-3-8(7-12-5-1)10-13-14-11(16-10)9-4-2-6-15-9/h2,4,6,8,12H,1,3,5,7H2

InChI key: InChIKey=VGQHXSKOTOTVRO-UHFFFAOYSA-N

SMILES: C=1(SC(=NN1)C2CCCNC2)C3=CC=CO3

Synonyms:

• 3-[5-(2-Furanyl)-1,3,4-thiadiazol-2-yl]piperidine
• Piperidine, 3-[5-(2-furanyl)-1,3,4-thiadiazol-2-yl]-