CAS 1105190-09-7
:Methyl 2-[(1,2-dihydro-1-oxo-5-isoquinolinyl)oxy]acetate
Description:
Methyl 2-[(1,2-dihydro-1-oxo-5-isoquinolinyl)oxy]acetate is a chemical compound characterized by its unique structure, which includes an isoquinoline moiety and an ester functional group. This compound typically exhibits properties associated with both the isoquinoline and ester classes, such as moderate polarity and potential biological activity. The presence of the isoquinoline ring suggests possible interactions with biological systems, making it of interest in medicinal chemistry. The ester functionality may contribute to its reactivity, allowing for hydrolysis or transesterification under certain conditions. Additionally, the compound may display solubility in organic solvents, which is common for esters, while its stability can be influenced by factors such as pH and temperature. Overall, Methyl 2-[(1,2-dihydro-1-oxo-5-isoquinolinyl)oxy]acetate represents a compound with potential applications in pharmaceuticals or as a synthetic intermediate, warranting further investigation into its chemical behavior and biological properties.
Formula:C12H11NO4
InChI:InChI=1S/C12H11NO4/c1-16-11(14)7-17-10-4-2-3-9-8(10)5-6-13-12(9)15/h2-6H,7H2,1H3,(H,13,15)
InChI key:InChIKey=NDBLWHBRHWWKJA-UHFFFAOYSA-N
SMILES:O(CC(OC)=O)C1=C2C(=CC=C1)C(=O)NC=C2
Synonyms:- Acetic acid, 2-[(1,2-dihydro-1-oxo-5-isoquinolinyl)oxy]-, methyl ester
- Methyl 2-[(1,2-dihydro-1-oxo-5-isoquinolinyl)oxy]acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.