CymitQuimica logo

CAS 1105190-16-6

:

5-(4-Bromophenyl)-1-(4-chlorophenyl)-1,3-dihydro-2H-imidazole-2-thione

Description:
5-(4-Bromophenyl)-1-(4-chlorophenyl)-1,3-dihydro-2H-imidazole-2-thione is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing nitrogen atoms. This specific compound features two aromatic substituents: a bromophenyl group and a chlorophenyl group, which contribute to its unique chemical properties and potential biological activity. The presence of the thione functional group (–C=S) indicates that it may exhibit properties similar to thioketones, potentially influencing its reactivity and interactions with other molecules. The compound's structure suggests it may be of interest in medicinal chemistry, particularly for its potential pharmacological applications. Additionally, the halogen substituents (bromine and chlorine) can enhance lipophilicity and influence the compound's binding affinity to biological targets. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C15H10BrClN2S
InChI:InChI=1S/C15H10BrClN2S/c16-11-3-1-10(2-4-11)14-9-18-15(20)19(14)13-7-5-12(17)6-8-13/h1-9H,(H,18,20)
InChI key:InChIKey=GCRKSGOMANNSIE-UHFFFAOYSA-N
SMILES:S=C1N(C(=CN1)C2=CC=C(Br)C=C2)C3=CC=C(Cl)C=C3
Synonyms:
  • 5-(4-Bromophenyl)-1-(4-chlorophenyl)-1,3-dihydro-2H-imidazole-2-thione
  • 2H-Imidazole-2-thione, 5-(4-bromophenyl)-1-(4-chlorophenyl)-1,3-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.