CAS 1105190-31-5

Ethyl 1-ethyl-1,2,3,4-tetrahydro-2-oxo-3-(phenylmethyl)-3-quinolinecarboxylate

Description:

Ethyl 1-ethyl-1,2,3,4-tetrahydro-2-oxo-3-(phenylmethyl)-3-quinolinecarboxylate is a synthetic organic compound characterized by its complex quinoline structure, which includes a tetrahydroquinoline moiety and an ethyl ester functional group. This compound typically exhibits properties associated with quinoline derivatives, such as potential biological activity, including antimicrobial or anticancer effects, due to the presence of the quinoline ring system. The ethyl ester group contributes to its solubility in organic solvents, making it suitable for various chemical reactions and applications in medicinal chemistry. The phenylmethyl substituent may enhance its lipophilicity, potentially influencing its pharmacokinetic properties. As with many quinoline derivatives, this compound may also exhibit fluorescence, which can be useful in analytical applications. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise values. Overall, this compound represents a class of molecules with significant interest in pharmaceutical research and development.

Formula: C₂₁H₂₃NO₃

InChI: InChI=1S/C21H23NO3/c1-3-22-18-13-9-8-12-17(18)15-21(19(22)23,20(24)25-4-2)14-16-10-6-5-7-11-16/h5-13H,3-4,14-15H2,1-2H3

InChI key: InChIKey=HNQUXLSNZSULTK-UHFFFAOYSA-N

SMILES: C(C1(C(OCC)=O)C(=O)N(CC)C=2C(C1)=CC=CC2)C3=CC=CC=C3

Synonyms:

• Ethyl 1-ethyl-1,2,3,4-tetrahydro-2-oxo-3-(phenylmethyl)-3-quinolinecarboxylate
• 3-Quinolinecarboxylic acid, 1-ethyl-1,2,3,4-tetrahydro-2-oxo-3-(phenylmethyl)-, ethyl ester