CAS 1105190-44-0

1,3-Dihydro-1-(2-methoxyethyl)-5-(4-methoxyphenyl)-2H-imidazole-2-thione

Description:

1,3-Dihydro-1-(2-methoxyethyl)-5-(4-methoxyphenyl)-2H-imidazole-2-thione is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The methoxyethyl and methoxyphenyl substituents enhance its solubility and may influence its pharmacological properties. Typically, compounds of this nature are investigated for their potential applications in medicinal chemistry, particularly for their roles in drug development due to their ability to interact with biological targets. The presence of multiple functional groups suggests that it may exhibit diverse chemical behavior, including potential antioxidant or anti-inflammatory properties. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₃H₁₆N₂O₂S

InChI: InChI=1S/C13H16N2O2S/c1-16-8-7-15-12(9-14-13(15)18)10-3-5-11(17-2)6-4-10/h3-6,9H,7-8H2,1-2H3,(H,14,18)

InChI key: InChIKey=VFAZUDZHTZDPKV-UHFFFAOYSA-N

SMILES: C(COC)N1C(=CNC1=S)C2=CC=C(OC)C=C2

Synonyms:

• 2H-Imidazole-2-thione, 1,3-dihydro-1-(2-methoxyethyl)-5-(4-methoxyphenyl)-
• 1,3-Dihydro-1-(2-methoxyethyl)-5-(4-methoxyphenyl)-2H-imidazole-2-thione