CAS 1105190-67-7

2-Chloro-3-[(2-fluorophenyl)methoxy]pyridine

Description:

2-Chloro-3-[(2-fluorophenyl)methoxy]pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the 2-position and a methoxy group linked to a 2-fluorophenyl moiety at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its polar functional groups. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the presence of halogen atoms can influence biological activity and lipophilicity. Additionally, the fluorine atom may enhance metabolic stability and bioavailability. The compound's reactivity can be influenced by the electron-withdrawing nature of the chloro and fluoro substituents, making it a candidate for various chemical reactions, including nucleophilic substitutions. Safety data and handling precautions should be observed, as with any chemical substance, due to potential toxicity or environmental impact.

Formula: C₁₂H₉ClFNO

InChI: InChI=1S/C12H9ClFNO/c13-12-11(6-3-7-15-12)16-8-9-4-1-2-5-10(9)14/h1-7H,8H2

InChI key: InChIKey=HHMPIMNGDYUZFW-UHFFFAOYSA-N

SMILES: C(OC1=C(Cl)N=CC=C1)C2=C(F)C=CC=C2

Synonyms:

• 2-Chloro-3-[(2-fluorophenyl)methoxy]pyridine
• Pyridine, 2-chloro-3-[(2-fluorophenyl)methoxy]-

2-chloro-3-[(2-fluorobenzyl)oxy]pyridine

CAS: 1105190-67-7

Formula: C₁₂H₉ClFNO

Purity: 95.0%

Molecular weight: 237.66

Ref: 10-F495629