CAS 1105190-85-9
:1,2,3,4,7,8-Hexahydro-1,3,8-trimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidine-6-carboxylic acid
Description:
1,2,3,4,7,8-Hexahydro-1,3,8-trimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidine-6-carboxylic acid is a complex organic compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features multiple functional groups, including carboxylic acid and ketone functionalities, contributing to its potential reactivity and solubility properties. The presence of three methyl groups suggests that it may exhibit hydrophobic characteristics, while the trioxo groups indicate potential for hydrogen bonding and interactions with polar solvents. Its molecular structure may confer biological activity, making it of interest in pharmaceutical research. The compound's CAS number, 1105190-85-9, allows for precise identification in chemical databases, facilitating further studies on its synthesis, properties, and potential applications. As with many complex organic molecules, understanding its behavior in various chemical environments is crucial for predicting its reactivity and potential uses in medicinal chemistry or materials science.
Formula:C11H11N3O5
InChI:InChI=1S/C11H11N3O5/c1-12-7-5(4-6(9(12)16)10(17)18)8(15)14(3)11(19)13(7)2/h4H,1-3H3,(H,17,18)
InChI key:InChIKey=HIWOWRIAAQWIGX-UHFFFAOYSA-N
SMILES:CN1C2=C(C=C(C(O)=O)C1=O)C(=O)N(C)C(=O)N2C
Synonyms:- 1,2,3,4,7,8-Hexahydro-1,3,8-trimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidine-6-carboxylic acid
- Pyrido[2,3-d]pyrimidine-6-carboxylic acid, 1,2,3,4,7,8-hexahydro-1,3,8-trimethyl-2,4,7-trioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.