CAS 1105191-24-9: 4,6-Dimethyl-N-(2-pyridinylmethyl)-2-benzothiazolamine

Description: 4,6-Dimethyl-N-(2-pyridinylmethyl)-2-benzothiazolamine is a chemical compound characterized by its complex structure, which includes a benzothiazole moiety and a pyridine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the dimethyl groups enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. The benzothiazole and pyridine components suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as they are often associated with various biological activities, including antimicrobial and anticancer properties. Additionally, the compound may exhibit specific reactivity due to the functional groups present, making it a candidate for further chemical modifications. Its CAS number, 1105191-24-9, allows for precise identification and retrieval of information regarding its properties, safety data, and potential applications in research and industry. Overall, this compound represents a unique structure with promising implications in chemical and pharmaceutical research.

Formula: C₁₅H₁₅N₃S

InChI: InChI=1S/C15H15N3S/c1-10-7-11(2)14-13(8-10)19-15(18-14)17-9-12-5-3-4-6-16-12/h3-8H,9H2,1-2H3,(H,17,18)

InChI key: InChIKey=VJPXCEJDGKRNGY-UHFFFAOYSA-N

SMILES: N=1C=CC=CC1CNC2=NC=3C(S2)=CC(=CC3C)C

Synonyms:

• 4,6-Dimethyl-N-(2-pyridinylmethyl)-2-benzothiazolamine
• 2-Benzothiazolamine, 4,6-dimethyl-N-(2-pyridinylmethyl)-

4,6-dimethyl-N-(pyridin-2-ylmethyl)-1,3-benzothiazol-2-amine

CAS: 1105191-24-9

• Purity: 95.0%
• Molecular weight: 269.3699951171875

4,6-Dimethyl-N-(pyridin-2-ylmethyl)-1,3-benzothiazol-2-amine

CAS: 1105191-24-9

Versatile small molecule scaffold

• Formula: C₁₅H₁₅N₃S
• Purity: Min. 95%
• Molecular weight: 269.4 g/mol