CAS 1105191-37-4

3,5-Dihydro-5-methyl-3-oxo-2-phenyl-2H-pyrazolo[4,3-c]pyridine-7-carboxylic acid

Description:

3,5-Dihydro-5-methyl-3-oxo-2-phenyl-2H-pyrazolo[4,3-c]pyridine-7-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyridine framework. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a phenyl group enhances its aromaticity and may influence its solubility and interaction with biological systems. The methyl and carbonyl groups in the structure suggest potential sites for chemical reactivity, making it of interest in medicinal chemistry and drug development. Its unique arrangement of atoms may impart specific biological activities, which could be explored in pharmacological studies. The compound's CAS number, 1105191-37-4, allows for precise identification in chemical databases, facilitating research and application in various fields, including organic synthesis and material science. Overall, this compound exemplifies the diversity of heterocyclic chemistry and its relevance in developing new therapeutic agents.

Formula: C₁₄H₁₁N₃O₃

InChI: InChI=1S/C14H11N3O3/c1-16-7-10-12(11(8-16)14(19)20)15-17(13(10)18)9-5-3-2-4-6-9/h2-8H,1H3,(H,19,20)

InChI key: InChIKey=ICXPWRPSTSMGOO-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(C(=O)N(N2)C3=CC=CC=C3)=CN(C)C1

Synonyms:

• 3,5-Dihydro-5-methyl-3-oxo-2-phenyl-2H-pyrazolo[4,3-c]pyridine-7-carboxylic acid
• 2H-Pyrazolo[4,3-c]pyridine-7-carboxylic acid, 3,5-dihydro-5-methyl-3-oxo-2-phenyl-