CAS 1105191-42-1

5-Ethyl-3,5-dihydro-3-oxo-2-phenyl-2H-pyrazolo[4,3-c]pyridine-7-carboxylic acid

Description:

5-Ethyl-3,5-dihydro-3-oxo-2-phenyl-2H-pyrazolo[4,3-c]pyridine-7-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyridine framework. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of an ethyl group and a phenyl ring enhances its lipophilicity and may influence its biological activity. The compound is likely to exhibit a range of chemical properties, including solubility in organic solvents and potential interactions with biological targets, making it of interest in medicinal chemistry. Its unique structure may also confer specific pharmacological properties, which could be explored in drug development. As with many heterocycles, it may participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions, depending on the functional groups present. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry, with potential applications in therapeutic contexts.

Formula: C₁₅H₁₃N₃O₃

InChI: InChI=1S/C15H13N3O3/c1-2-17-8-11-13(12(9-17)15(20)21)16-18(14(11)19)10-6-4-3-5-7-10/h3-9H,2H2,1H3,(H,20,21)

InChI key: InChIKey=UBQDGFQSXWROPO-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(C(=O)N(N2)C3=CC=CC=C3)=CN(CC)C1

Synonyms:

• 2H-Pyrazolo[4,3-c]pyridine-7-carboxylic acid, 5-ethyl-3,5-dihydro-3-oxo-2-phenyl-
• 5-Ethyl-3,5-dihydro-3-oxo-2-phenyl-2H-pyrazolo[4,3-c]pyridine-7-carboxylic acid