CymitQuimica logo

CAS 1105191-47-6

:

3,5-Dihydro-3-oxo-2-phenyl-5-propyl-2H-pyrazolo[4,3-c]pyridine-7-carboxylic acid

Description:
3,5-Dihydro-3-oxo-2-phenyl-5-propyl-2H-pyrazolo[4,3-c]pyridine-7-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyridine framework. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of phenyl and propyl substituents enhances its hydrophobic characteristics, which may influence its solubility and biological activity. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of multiple functional groups that can interact with biological targets. Its molecular properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and solvent used. Additionally, the compound may exhibit interesting pharmacological activities, making it a subject of interest for further research in drug discovery and development. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C16H15N3O3
InChI:InChI=1S/C16H15N3O3/c1-2-8-18-9-12-14(13(10-18)16(21)22)17-19(15(12)20)11-6-4-3-5-7-11/h3-7,9-10H,2,8H2,1H3,(H,21,22)
InChI key:InChIKey=RKAIQZFHMHMAEQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(C(=O)N(N2)C3=CC=CC=C3)=CN(CCC)C1
Synonyms:
  • 3,5-Dihydro-3-oxo-2-phenyl-5-propyl-2H-pyrazolo[4,3-c]pyridine-7-carboxylic acid
  • 2H-Pyrazolo[4,3-c]pyridine-7-carboxylic acid, 3,5-dihydro-3-oxo-2-phenyl-5-propyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.